C15H25NO4 — CID 125492924
diethyl (4R,4aR,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4,6-dicarboxylate (PubChem CID 125492924) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is diethyl (4R,4aR,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4,6-dicarboxylate.
| Compound Name | diethyl (4R,4aR,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4,6-dicarboxylate |
|---|---|
| PubChem CID | 125492924 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | diethyl (4R,4aR,6R,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H]2NCC[C@@H](C(=O)OCC)[C@H]2C1 |
| InChI | InChI=1S/C15H25NO4/c1-3-19-14(17)10-5-6-13-12(9-10)11(7-8-16-13)15(18)20-4-2/h10-13,16H,3-9H2,1-2H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | SXMGZXJAZUCGCJ-LPWJVIDDSA-N |
| XLogP | 1.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |