C19H14BrF4N3O2 — CID 130178349
(2-bromo-3-fluorophenyl)-[5-[5-(trifluoromethyl)pyrazin-2-yl]oxy-2-azatricyclo[4.2.0.01,3]octan-2-yl]methanone (PubChem CID 130178349) has the molecular formula C19H14BrF4N3O2 and a molecular weight of 472.24 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-[5-[5-(trifluoromethyl)pyrazin-2-yl]oxy-2-azatricyclo[4.2.0.01,3]octan-2-yl]methanone.
| Compound Name | (2-bromo-3-fluorophenyl)-[5-[5-(trifluoromethyl)pyrazin-2-yl]oxy-2-azatricyclo[4.2.0.01,3]octan-2-yl]methanone |
|---|---|
| PubChem CID | 130178349 |
| Molecular Formula | C19H14BrF4N3O2 |
| Molecular Weight | 472.24 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-[5-[5-(trifluoromethyl)pyrazin-2-yl]oxy-2-azatricyclo[4.2.0.01,3]octan-2-yl]methanone |
| SMILES | O=C(c1cccc(F)c1Br)N1C2CC(Oc3cnc(C(F)(F)F)cn3)C3CCC321 |
| InChI | InChI=1S/C19H14BrF4N3O2/c20-16-9(2-1-3-11(16)21)17(28)27-14-6-12(10-4-5-18(10,14)27)29-15-8-25-13(7-26-15)19(22,23)24/h1-3,7-8,10,12,14H,4-6H2 |
| InChIKey | MCWSPMHUEDPVNY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|