C11H9BrFNO — CID 131086480
(2-bromo-3-fluorophenyl)-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 131086480) has the molecular formula C11H9BrFNO and a molecular weight of 270.10 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | (2-bromo-3-fluorophenyl)-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 131086480 |
| Molecular Formula | C11H9BrFNO |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | O=C(c1cccc(F)c1Br)N1CC=CC1 |
| InChI | InChI=1S/C11H9BrFNO/c12-10-8(4-3-5-9(10)13)11(15)14-6-1-2-7-14/h1-5H,6-7H2 |
| InChIKey | QDZGRAPFKKMMRZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|