About 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine
1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine (PubChem CID 13017864) has the molecular formula C19H27NO
and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine.
Molecular Properties
| Compound Name | 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine |
| PubChem CID | 13017864 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine |
| SMILES | NC1CCC2(CC1)OC(C1CCCCC1)c1ccccc12 |
| InChI | InChI=1S/C19H27NO/c20-15-10-12-19(13-11-15)17-9-5-4-8-16(17)18(21-19)14-6-2-1-3-7-14/h4-5,8-9,14-15,18H,1-3,6-7,10-13,20H2 |
| InChIKey | XKEGFXQQGJHDNN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
The IUPAC name of 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine (CID 13017864) is 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine.
What is the SMILES notation for 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
The canonical SMILES for 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine is NC1CCC2(CC1)OC(C1CCCCC1)c1ccccc12.
What is the InChIKey of 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
The InChIKey is XKEGFXQQGJHDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO/c20-15-10-12-19(13-11-15)17-9-5-4-8-16(17)18(21-19)14-6-2-1-3-7-14/h4-5,8-9,14-15,18H,1-3,6-7,10-13,20H2.
What are the key properties of 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine?
1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine has a molecular weight of 285.43 g/mol, XLogP of 4.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylspiro[1H-2-benzofuran-3,4'-cyclohexane]-1'-amine is sourced from PubChem (CID 13017864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).