C24H26F3N5O3 — CID 130178683
[[5-(5-ethoxy-6-morpholin-4-ylpyrazin-2-yl)-6-methyl-3-pyridinyl]amino]-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 130178683) has the molecular formula C24H26F3N5O3 and a molecular weight of 489.50 g/mol. Its IUPAC name is [[5-(5-ethoxy-6-morpholin-4-ylpyrazin-2-yl)-6-methyl-3-pyridinyl]amino]-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | [[5-(5-ethoxy-6-morpholin-4-ylpyrazin-2-yl)-6-methyl-3-pyridinyl]amino]-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 130178683 |
| Molecular Formula | C24H26F3N5O3 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [[5-(5-ethoxy-6-morpholin-4-ylpyrazin-2-yl)-6-methyl-3-pyridinyl]amino]-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | CCOc1ncc(-c2cc(NC(O)c3cccc(C(F)(F)F)c3)cnc2C)nc1N1CCOCC1 |
| InChI | InChI=1S/C24H26F3N5O3/c1-3-35-23-21(32-7-9-34-10-8-32)31-20(14-29-23)19-12-18(13-28-15(19)2)30-22(33)16-5-4-6-17(11-16)24(25,26)27/h4-6,11-14,22,30,33H,3,7-10H2,1-2H3 |
| InChIKey | ZCNIZVSSRJVFDL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|