C8H15FO — CID 130179287
[(1S,2R,3R)-3-fluoro-2,4-dimethylcyclopentyl]methanol (PubChem CID 130179287) has the molecular formula C8H15FO and a molecular weight of 146.21 g/mol. Its IUPAC name is [(1S,2R,3R)-3-fluoro-2,4-dimethylcyclopentyl]methanol.
| Compound Name | [(1S,2R,3R)-3-fluoro-2,4-dimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 130179287 |
| Molecular Formula | C8H15FO |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | [(1S,2R,3R)-3-fluoro-2,4-dimethylcyclopentyl]methanol |
| SMILES | CC1C[C@H](CO)[C@@H](C)[C@@H]1F |
| InChI | InChI=1S/C8H15FO/c1-5-3-7(4-10)6(2)8(5)9/h5-8,10H,3-4H2,1-2H3/t5?,6-,7-,8-/m1/s1 |
| InChIKey | GTGRDUWYNITSFB-UIYHXYAWSA-N |
| XLogP | 1.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |