C11H17N3 — CID 130180540
N'-[(E)-but-2-en-2-yl]-N-(3-ethenyliminobutan-2-ylidene)methanimidamide (PubChem CID 130180540) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N'-[(E)-but-2-en-2-yl]-N-(3-ethenyliminobutan-2-ylidene)methanimidamide.
| Compound Name | N'-[(E)-but-2-en-2-yl]-N-(3-ethenyliminobutan-2-ylidene)methanimidamide |
|---|---|
| PubChem CID | 130180540 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N'-[(E)-but-2-en-2-yl]-N-(3-ethenyliminobutan-2-ylidene)methanimidamide |
| SMILES | C=C/N=C(C)/C(C)=N/C=N/C(C)=C/C |
| InChI | InChI=1S/C11H17N3/c1-6-9(3)13-8-14-11(5)10(4)12-7-2/h6-8H,2H2,1,3-5H3/b9-6+,12-10+,13-8+,14-11+ |
| InChIKey | HSUPZQZTFJLGDG-AQQYKAACSA-N |
| XLogP | 3.00 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|