About N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane
N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane (PubChem CID 143774549) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane.
Molecular Properties
| Compound Name | N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane |
| PubChem CID | 143774549 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane |
| SMILES | C=N/C(C)=N/C(C)=C\C.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-5-6(2)9-7(3)8-4;1-2/h5H,4H2,1-3H3;1-2H3/b6-5-,9-7+; |
| InChIKey | ZZTAJFSTWHPUMT-HMERWLGPSA-N |
| XLogP | 3.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane?
The IUPAC name of N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane (CID 143774549) is N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane.
What is the SMILES notation for N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane?
The canonical SMILES for N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane is C=N/C(C)=N/C(C)=C\C.CC.
What is the InChIKey of N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane?
The InChIKey is ZZTAJFSTWHPUMT-HMERWLGPSA-N. The full InChI is InChI=1S/C7H12N2.C2H6/c1-5-6(2)9-7(3)8-4;1-2/h5H,4H2,1-3H3;1-2H3/b6-5-,9-7+;.
What are the key properties of N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane?
N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane has a molecular weight of 154.26 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-but-2-en-2-yl]-N-methylideneethanimidamide;ethane is sourced from PubChem (CID 143774549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).