C45H50N2 — CID 130180713
4-[5-(4a,4b,8a,10a-tetrahydrophenanthren-3-yl)-3-(6-propan-2-yl-1,2-dihydropyridin-4-yl)cyclohexen-1-yl]-2-cyclohexa-1,5-dien-1-yl-6-cyclohex-2-en-1-ylpyridine (PubChem CID 130180713) has the molecular formula C45H50N2 and a molecular weight of 618.91 g/mol. Its IUPAC name is 4-[5-(4a,4b,8a,10a-tetrahydrophenanthren-3-yl)-3-(6-propan-2-yl-1,2-dihydropyridin-4-yl)cyclohexen-1-yl]-2-cyclohexa-1,5-dien-1-yl-6-cyclohex-2-en-1-ylpyridine.
| Compound Name | 4-[5-(4a,4b,8a,10a-tetrahydrophenanthren-3-yl)-3-(6-propan-2-yl-1,2-dihydropyridin-4-yl)cyclohexen-1-yl]-2-cyclohexa-1,5-dien-1-yl-6-cyclohex-2-en-1-ylpyridine |
|---|---|
| PubChem CID | 130180713 |
| Molecular Formula | C45H50N2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.40 |
| IUPAC Name | 4-[5-(4a,4b,8a,10a-tetrahydrophenanthren-3-yl)-3-(6-propan-2-yl-1,2-dihydropyridin-4-yl)cyclohexen-1-yl]-2-cyclohexa-1,5-dien-1-yl-6-cyclohex-2-en-1-ylpyridine |
| SMILES | CC(C)C1=CC(C2C=C(c3cc(C4=CCCC=C4)nc(C4C=CCCC4)c3)CC(C3=CC4C(C=C3)C=CC3C=CC=CC34)C2)=CCN1 |
| InChI | InChI=1S/C45H50N2/c1-30(2)43-27-36(21-22-46-43)38-23-37(35-20-19-32-18-17-31-11-9-10-16-41(31)42(32)26-35)24-39(25-38)40-28-44(33-12-5-3-6-13-33)47-45(29-40)34-14-7-4-8-15-34/h5,7,9-14,16-21,25-32,34,37-38,41-42,46H,3-4,6,8,15,22-24H2,1-2H3 |
| InChIKey | JGUJZWUQTPQWQY-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|