C48H45N5 — CID 130180884
1-[4-[4,6-bis(4-naphthalen-1-ylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl]phenyl]-N-methyl-N'-[(E)-pent-3-en-2-yl]methanediamine (PubChem CID 130180884) has the molecular formula C48H45N5 and a molecular weight of 691.92 g/mol. Its IUPAC name is 1-[4-[4,6-bis(4-naphthalen-1-ylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl]phenyl]-N-methyl-N'-[(E)-pent-3-en-2-yl]methanediamine.
| Compound Name | 1-[4-[4,6-bis(4-naphthalen-1-ylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl]phenyl]-N-methyl-N'-[(E)-pent-3-en-2-yl]methanediamine |
|---|---|
| PubChem CID | 130180884 |
| Molecular Formula | C48H45N5 |
| Molecular Weight | 691.92 g/mol |
| Exact Mass | 691.37 |
| IUPAC Name | 1-[4-[4,6-bis(4-naphthalen-1-ylphenyl)-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl]phenyl]-N-methyl-N'-[(E)-pent-3-en-2-yl]methanediamine |
| SMILES | C/C=C/C(C)NC(NC)c1ccc(C2NC(c3ccc(-c4cccc5ccccc45)cc3)=NC(c3ccc(-c4cccc5ccccc45)cc3)N2)cc1 |
| InChI | InChI=1S/C48H45N5/c1-4-11-32(2)50-45(49-3)37-28-30-40(31-29-37)48-52-46(38-24-20-35(21-25-38)43-18-9-14-33-12-5-7-16-41(33)43)51-47(53-48)39-26-22-36(23-27-39)44-19-10-15-34-13-6-8-17-42(34)44/h4-32,45-46,48-50,52H,1-3H3,(H,51,53)/b11-4+ |
| InChIKey | IQQNWOTUWSFQMS-NYYWCZLTSA-N |
| XLogP | 10.44 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.92 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|