C17H14F6N2O2 — CID 130182467
2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetaldehyde (PubChem CID 130182467) has the molecular formula C17H14F6N2O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetaldehyde.
| Compound Name | 2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 130182467 |
| Molecular Formula | C17H14F6N2O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetaldehyde |
| SMILES | O=CCn1c(CCCC(F)(F)F)nc(-c2ccc(C(F)(F)F)cc2)cc1=O |
| InChI | InChI=1S/C17H14F6N2O2/c18-16(19,20)7-1-2-14-24-13(10-15(27)25(14)8-9-26)11-3-5-12(6-4-11)17(21,22)23/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | LFIDHOKVSJQGIT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|