C35H30F12N4O5 — CID 160791840
3-(2-oxopropyl)-2-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-one;2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetic acid (PubChem CID 160791840) has the molecular formula C35H30F12N4O5 and a molecular weight of 814.62 g/mol. Its IUPAC name is 3-(2-oxopropyl)-2-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-one;2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetic acid.
| Compound Name | 3-(2-oxopropyl)-2-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-one;2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 160791840 |
| Molecular Formula | C35H30F12N4O5 |
| Molecular Weight | 814.62 g/mol |
| Exact Mass | 814.20 |
| IUPAC Name | 3-(2-oxopropyl)-2-(4,4,4-trifluorobutyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-one;2-[6-oxo-2-(4,4,4-trifluorobutyl)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]acetic acid |
| SMILES | CC(=O)Cn1c(CCCC(F)(F)F)nc(-c2ccc(C(F)(F)F)cc2)cc1=O.O=C(O)Cn1c(CCCC(F)(F)F)nc(-c2ccc(C(F)(F)F)cc2)cc1=O |
| InChI | InChI=1S/C18H16F6N2O2.C17H14F6N2O3/c1-11(27)10-26-15(3-2-8-17(19,20)21)25-14(9-16(26)28)12-4-6-13(7-5-12)18(22,23)24;18-16(19,20)7-1-2-13-24-12(8-14(26)25(13)9-15(27)28)10-3-5-11(6-4-10)17(21,22)23/h4-7,9H,2-3,8,10H2,1H3;3-6,8H,1-2,7,9H2,(H,27,28) |
| InChIKey | SBXSDPAGUKSZHR-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.62 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |