About methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate
methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate (PubChem CID 130182689) has the molecular formula C11H12ClF3N2O3
and a molecular weight of 312.68 g/mol. Its IUPAC name is methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate |
| PubChem CID | 130182689 |
| Molecular Formula | C11H12ClF3N2O3 |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate |
| SMILES | COC(=O)Cn1c(CCCC(F)(F)F)nc(Cl)cc1=O |
| InChI | InChI=1S/C11H12ClF3N2O3/c1-20-10(19)6-17-8(3-2-4-11(13,14)15)16-7(12)5-9(17)18/h5H,2-4,6H2,1H3 |
| InChIKey | UUYGDNAGQWSMQP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate?
The IUPAC name of methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate (CID 130182689) is methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate.
What is the SMILES notation for methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate?
The canonical SMILES for methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate is COC(=O)Cn1c(CCCC(F)(F)F)nc(Cl)cc1=O.
What is the InChIKey of methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate?
The InChIKey is UUYGDNAGQWSMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF3N2O3/c1-20-10(19)6-17-8(3-2-4-11(13,14)15)16-7(12)5-9(17)18/h5H,2-4,6H2,1H3.
What are the key properties of methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate?
methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate has a molecular weight of 312.68 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-chloro-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetate is sourced from PubChem (CID 130182689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).