C10H12ClF3N2O2 — CID 114584477
6-chloro-2-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one (PubChem CID 114584477) has the molecular formula C10H12ClF3N2O2 and a molecular weight of 284.67 g/mol. Its IUPAC name is 6-chloro-2-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one.
| Compound Name | 6-chloro-2-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114584477 |
| Molecular Formula | C10H12ClF3N2O2 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 6-chloro-2-ethyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-one |
| SMILES | CCc1nc(Cl)cc(=O)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2O2/c1-2-8-15-7(11)5-9(17)16(8)3-4-18-6-10(12,13)14/h5H,2-4,6H2,1H3 |
| InChIKey | LLTJBEVYVHAOQI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|