C21H37FN2O2 — CID 130183009
(E,2E)-4-[[acetyl(4-fluorobutyl)amino]methyl]-2-ethylidene-N,N-dipropylhex-3-enamide (PubChem CID 130183009) has the molecular formula C21H37FN2O2 and a molecular weight of 368.54 g/mol. Its IUPAC name is (E,2E)-4-[[acetyl(4-fluorobutyl)amino]methyl]-2-ethylidene-N,N-dipropylhex-3-enamide.
| Compound Name | (E,2E)-4-[[acetyl(4-fluorobutyl)amino]methyl]-2-ethylidene-N,N-dipropylhex-3-enamide |
|---|---|
| PubChem CID | 130183009 |
| Molecular Formula | C21H37FN2O2 |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | (E,2E)-4-[[acetyl(4-fluorobutyl)amino]methyl]-2-ethylidene-N,N-dipropylhex-3-enamide |
| SMILES | C/C=C(\C=C(/CC)CN(CCCCF)C(C)=O)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C21H37FN2O2/c1-6-13-23(14-7-2)21(26)20(9-4)16-19(8-3)17-24(18(5)25)15-11-10-12-22/h9,16H,6-8,10-15,17H2,1-5H3/b19-16+,20-9+ |
| InChIKey | ZZGCFIXJQWSFPC-WQBGIHHKSA-N |
| XLogP | 4.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|