About 3-bromo-1-sulfanylindole
3-bromo-1-sulfanylindole (PubChem CID 130183431) has the molecular formula C8H6BrNS
and a molecular weight of 228.11 g/mol. Its IUPAC name is 3-bromo-1-sulfanylindole.
Molecular Properties
| Compound Name | 3-bromo-1-sulfanylindole |
| PubChem CID | 130183431 |
| Molecular Formula | C8H6BrNS |
| Molecular Weight | 228.11 g/mol |
| Exact Mass | 226.94 |
| IUPAC Name | 3-bromo-1-sulfanylindole |
| SMILES | Sn1cc(Br)c2ccccc21 |
| InChI | InChI=1S/C8H6BrNS/c9-7-5-10(11)8-4-2-1-3-6(7)8/h1-5,11H |
| InChIKey | ARCZLDAWUMBFKI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.11 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-sulfanylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-sulfanylindole?
The IUPAC name of 3-bromo-1-sulfanylindole (CID 130183431) is 3-bromo-1-sulfanylindole.
What is the SMILES notation for 3-bromo-1-sulfanylindole?
The canonical SMILES for 3-bromo-1-sulfanylindole is Sn1cc(Br)c2ccccc21.
What is the InChIKey of 3-bromo-1-sulfanylindole?
The InChIKey is ARCZLDAWUMBFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNS/c9-7-5-10(11)8-4-2-1-3-6(7)8/h1-5,11H.
What are the key properties of 3-bromo-1-sulfanylindole?
3-bromo-1-sulfanylindole has a molecular weight of 228.11 g/mol, XLogP of 3.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-sulfanylindole is sourced from PubChem (CID 130183431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).