C27H37ClN4OS — CID 130183548
N-(2-chloro-4-methylphenyl)-2-[1-[2-[pentyl(propyl)amino]ethyl]benzimidazol-2-yl]sulfanylpropanamide (PubChem CID 130183548) has the molecular formula C27H37ClN4OS and a molecular weight of 501.14 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[1-[2-[pentyl(propyl)amino]ethyl]benzimidazol-2-yl]sulfanylpropanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[1-[2-[pentyl(propyl)amino]ethyl]benzimidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 130183548 |
| Molecular Formula | C27H37ClN4OS |
| Molecular Weight | 501.14 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[1-[2-[pentyl(propyl)amino]ethyl]benzimidazol-2-yl]sulfanylpropanamide |
| SMILES | CCCCCN(CCC)CCn1c(SC(C)C(=O)Nc2ccc(C)cc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C27H37ClN4OS/c1-5-7-10-16-31(15-6-2)17-18-32-25-12-9-8-11-24(25)30-27(32)34-21(4)26(33)29-23-14-13-20(3)19-22(23)28/h8-9,11-14,19,21H,5-7,10,15-18H2,1-4H3,(H,29,33) |
| InChIKey | DCJFTTITKTYICA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.14 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|