C11H17N3O3S — CID 130186762
(2S)-2-(pentanoylamino)-3-(4-sulfanyl-1H-imidazol-5-yl)propanoic acid (PubChem CID 130186762) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2S)-2-(pentanoylamino)-3-(4-sulfanyl-1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-(pentanoylamino)-3-(4-sulfanyl-1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 130186762 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2S)-2-(pentanoylamino)-3-(4-sulfanyl-1H-imidazol-5-yl)propanoic acid |
| SMILES | CCCCC(=O)N[C@@H](Cc1[nH]cnc1S)C(=O)O |
| InChI | InChI=1S/C11H17N3O3S/c1-2-3-4-9(15)14-8(11(16)17)5-7-10(18)13-6-12-7/h6,8,18H,2-5H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | MIPBDFLQAFEFGI-QMMMGPOBSA-N |
| XLogP | 1.00 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|