C16H15ClN2OS — CID 130191277
2-tert-butyl-6-chloro-7-pyridin-2-ylsulfanyl-1,3-benzoxazole (PubChem CID 130191277) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-7-pyridin-2-ylsulfanyl-1,3-benzoxazole.
| Compound Name | 2-tert-butyl-6-chloro-7-pyridin-2-ylsulfanyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 130191277 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-tert-butyl-6-chloro-7-pyridin-2-ylsulfanyl-1,3-benzoxazole |
| SMILES | CC(C)(C)c1nc2ccc(Cl)c(Sc3ccccn3)c2o1 |
| InChI | InChI=1S/C16H15ClN2OS/c1-16(2,3)15-19-11-8-7-10(17)14(13(11)20-15)21-12-6-4-5-9-18-12/h4-9H,1-3H3 |
| InChIKey | SMTFRACIUSIARO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |