C18H25ClN2O3S — CID 130191282
2-tert-butyl-6-chloro-7-(1-ethylpiperidin-4-yl)sulfonyl-1,3-benzoxazole (PubChem CID 130191282) has the molecular formula C18H25ClN2O3S and a molecular weight of 384.93 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-7-(1-ethylpiperidin-4-yl)sulfonyl-1,3-benzoxazole.
| Compound Name | 2-tert-butyl-6-chloro-7-(1-ethylpiperidin-4-yl)sulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 130191282 |
| Molecular Formula | C18H25ClN2O3S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-tert-butyl-6-chloro-7-(1-ethylpiperidin-4-yl)sulfonyl-1,3-benzoxazole |
| SMILES | CCN1CCC(S(=O)(=O)c2c(Cl)ccc3nc(C(C)(C)C)oc23)CC1 |
| InChI | InChI=1S/C18H25ClN2O3S/c1-5-21-10-8-12(9-11-21)25(22,23)16-13(19)6-7-14-15(16)24-17(20-14)18(2,3)4/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | OTKVZOSKUZCKAB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |