C23H25F2IN4O4 — CID 130191591
(4R)-N-[(2,4-difluoro-5-iodophenyl)methyl]-6-ethyl-2-(ethylamino)-9-methoxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide (PubChem CID 130191591) has the molecular formula C23H25F2IN4O4 and a molecular weight of 586.38 g/mol. Its IUPAC name is (4R)-N-[(2,4-difluoro-5-iodophenyl)methyl]-6-ethyl-2-(ethylamino)-9-methoxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide.
| Compound Name | (4R)-N-[(2,4-difluoro-5-iodophenyl)methyl]-6-ethyl-2-(ethylamino)-9-methoxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
|---|---|
| PubChem CID | 130191591 |
| Molecular Formula | C23H25F2IN4O4 |
| Molecular Weight | 586.38 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | (4R)-N-[(2,4-difluoro-5-iodophenyl)methyl]-6-ethyl-2-(ethylamino)-9-methoxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
| SMILES | CCNC1C[C@@H]2CN(CC)C(=O)c3c(OC)c(=O)c(C(=O)NCc4cc(I)c(F)cc4F)c1n32 |
| InChI | InChI=1S/C23H25F2IN4O4/c1-4-27-16-7-12-10-29(5-2)23(33)19-21(34-3)20(31)17(18(16)30(12)19)22(32)28-9-11-6-15(26)14(25)8-13(11)24/h6,8,12,16,27H,4-5,7,9-10H2,1-3H3,(H,28,32)/t12-,16?/m1/s1 |
| InChIKey | ZPSNJYRSFIUWNA-ZGTOLYCTSA-N |
| XLogP | 2.74 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|