C17H28O11 — CID 130194321
4-acetyl-3,5,7-trihydroxy-6-(1-hydroxypropyl)nonane-3,4,5-tricarboxylic acid (PubChem CID 130194321) has the molecular formula C17H28O11 and a molecular weight of 408.40 g/mol. Its IUPAC name is 4-acetyl-3,5,7-trihydroxy-6-(1-hydroxypropyl)nonane-3,4,5-tricarboxylic acid.
| Compound Name | 4-acetyl-3,5,7-trihydroxy-6-(1-hydroxypropyl)nonane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 130194321 |
| Molecular Formula | C17H28O11 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-acetyl-3,5,7-trihydroxy-6-(1-hydroxypropyl)nonane-3,4,5-tricarboxylic acid |
| SMILES | CCC(O)C(C(C)=O)(C(=O)O)C(O)(C(=O)O)C(C(=O)O)(C(O)CC)C(O)CC |
| InChI | InChI=1S/C17H28O11/c1-5-9(19)15(8(4)18,12(22)23)17(28,14(26)27)16(13(24)25,10(20)6-2)11(21)7-3/h9-11,19-21,28H,5-7H2,1-4H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | TYWWHSYLXUDDEI-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 209.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|