C9H18O7 — CID 155126686
3,4,4,6,6,7-hexahydroxynonan-5-one (PubChem CID 155126686) has the molecular formula C9H18O7 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3,4,4,6,6,7-hexahydroxynonan-5-one.
| Compound Name | 3,4,4,6,6,7-hexahydroxynonan-5-one |
|---|---|
| PubChem CID | 155126686 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3,4,4,6,6,7-hexahydroxynonan-5-one |
| SMILES | CCC(O)C(O)(O)C(=O)C(O)(O)C(O)CC |
| InChI | InChI=1S/C9H18O7/c1-3-5(10)8(13,14)7(12)9(15,16)6(11)4-2/h5-6,10-11,13-16H,3-4H2,1-2H3 |
| InChIKey | BVRVMOXBYYUANF-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|