C14H24O5 — CID 134892672
(E,10S,11R)-10,11-dihydroxy-10-methyl-7-oxotridec-8-enoic acid (PubChem CID 134892672) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (E,10S,11R)-10,11-dihydroxy-10-methyl-7-oxotridec-8-enoic acid.
| Compound Name | (E,10S,11R)-10,11-dihydroxy-10-methyl-7-oxotridec-8-enoic acid |
|---|---|
| PubChem CID | 134892672 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (E,10S,11R)-10,11-dihydroxy-10-methyl-7-oxotridec-8-enoic acid |
| SMILES | CC[C@@H](O)[C@@](C)(O)/C=C/C(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C14H24O5/c1-3-12(16)14(2,19)10-9-11(15)7-5-4-6-8-13(17)18/h9-10,12,16,19H,3-8H2,1-2H3,(H,17,18)/b10-9+/t12-,14+/m1/s1 |
| InChIKey | YJOBYLVGHNBWFU-MEBOZDAKSA-N |
| XLogP | 1.67 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|