About 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid
2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid (PubChem CID 138708143) has the molecular formula C23H44O3
and a molecular weight of 368.60 g/mol. Its IUPAC name is 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid |
| PubChem CID | 138708143 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid |
| SMILES | C=CC(C)(C)O.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C5H10O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5(2,3)6/h9-10H,2-8,11-17H2,1H3,(H,19,20);4,6H,1H2,2-3H3/b10-9-; |
| InChIKey | ITDXRFQZZXREDB-KVVVOXFISA-N |
| XLogP | 7.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid?
The IUPAC name of 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid (CID 138708143) is 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid.
What is the SMILES notation for 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid?
The canonical SMILES for 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid is C=CC(C)(C)O.CCCCCCCC/C=C\CCCCCCCC(=O)O.
What is the InChIKey of 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid?
The InChIKey is ITDXRFQZZXREDB-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C5H10O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-5(2,3)6/h9-10H,2-8,11-17H2,1H3,(H,19,20);4,6H,1H2,2-3H3/b10-9-;.
What are the key properties of 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid?
2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid has a molecular weight of 368.60 g/mol, XLogP of 7.05, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-ol;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 138708143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).