C14H24O4 — CID 123886978
(8R)-8-hydroxy-3,4,7,7-tetramethyldecane-2,5,6-trione (PubChem CID 123886978) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (8R)-8-hydroxy-3,4,7,7-tetramethyldecane-2,5,6-trione.
| Compound Name | (8R)-8-hydroxy-3,4,7,7-tetramethyldecane-2,5,6-trione |
|---|---|
| PubChem CID | 123886978 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (8R)-8-hydroxy-3,4,7,7-tetramethyldecane-2,5,6-trione |
| SMILES | CC[C@@H](O)C(C)(C)C(=O)C(=O)C(C)C(C)C(C)=O |
| InChI | InChI=1S/C14H24O4/c1-7-11(16)14(5,6)13(18)12(17)9(3)8(2)10(4)15/h8-9,11,16H,7H2,1-6H3/t8?,9?,11-/m1/s1 |
| InChIKey | XQCJRXCBZMPRPP-NWGYLPEXSA-N |
| XLogP | 1.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|