C25H24FN5O3S — CID 130194334
5-[2-[(4-amino-3-methanimidoylbenzoyl)amino]acetyl]-N-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide (PubChem CID 130194334) has the molecular formula C25H24FN5O3S and a molecular weight of 493.56 g/mol. Its IUPAC name is 5-[2-[(4-amino-3-methanimidoylbenzoyl)amino]acetyl]-N-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | 5-[2-[(4-amino-3-methanimidoylbenzoyl)amino]acetyl]-N-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130194334 |
| Molecular Formula | C25H24FN5O3S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 5-[2-[(4-amino-3-methanimidoylbenzoyl)amino]acetyl]-N-[(2-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
| SMILES | [H]/N=C/c1cc(C(=O)NCC(=O)N2CCc3sc(C(=O)NCc4ccccc4F)cc3C2)ccc1N |
| InChI | InChI=1S/C25H24FN5O3S/c26-19-4-2-1-3-16(19)12-29-25(34)22-10-18-14-31(8-7-21(18)35-22)23(32)13-30-24(33)15-5-6-20(28)17(9-15)11-27/h1-6,9-11,27H,7-8,12-14,28H2,(H,29,34)(H,30,33)/b27-11+ |
| InChIKey | FEAYMLHHSATQPQ-LUOAPIJWSA-N |
| XLogP | 2.71 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|