C26H26FN5O3S — CID 130194056
5-[(2R)-2-[(4-amino-2-fluoro-5-methanimidoylbenzoyl)amino]butanoyl]-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide (PubChem CID 130194056) has the molecular formula C26H26FN5O3S and a molecular weight of 507.59 g/mol. Its IUPAC name is 5-[(2R)-2-[(4-amino-2-fluoro-5-methanimidoylbenzoyl)amino]butanoyl]-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | 5-[(2R)-2-[(4-amino-2-fluoro-5-methanimidoylbenzoyl)amino]butanoyl]-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130194056 |
| Molecular Formula | C26H26FN5O3S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 5-[(2R)-2-[(4-amino-2-fluoro-5-methanimidoylbenzoyl)amino]butanoyl]-N-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxamide |
| SMILES | [H]/N=C/c1cc(C(=O)N[C@H](CC)C(=O)N2CCc3sc(C(=O)Nc4ccccc4)cc3C2)c(F)cc1N |
| InChI | InChI=1S/C26H26FN5O3S/c1-2-21(31-24(33)18-10-15(13-28)20(29)12-19(18)27)26(35)32-9-8-22-16(14-32)11-23(36-22)25(34)30-17-6-4-3-5-7-17/h3-7,10-13,21,28H,2,8-9,14,29H2,1H3,(H,30,34)(H,31,33)/b28-13+/t21-/m1/s1 |
| InChIKey | MSUZHPSMHAOIJJ-PXHAWYGPSA-N |
| XLogP | 3.81 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|