C28H29FN4O4S — CID 70244552
ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-fluorophenyl)propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate (PubChem CID 70244552) has the molecular formula C28H29FN4O4S and a molecular weight of 536.63 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-fluorophenyl)propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-fluorophenyl)propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 70244552 |
| Molecular Formula | C28H29FN4O4S |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-fluorophenyl)propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N2CCc3sc(CC(=O)OCC)cc3C2)cc1 |
| InChI | InChI=1S/C28H29FN4O4S/c1-2-37-25(34)15-22-14-20-16-33(12-11-24(20)38-22)28(36)23(13-17-3-9-21(29)10-4-17)32-27(35)19-7-5-18(6-8-19)26(30)31/h3-10,14,23H,2,11-13,15-16H2,1H3,(H3,30,31)(H,32,35)/t23-/m0/s1 |
| InChIKey | LESTVWPPXHYYIQ-QHCPKHFHSA-N |
| XLogP | 3.20 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|