C31H34F3N5O8S2 — CID 70247387
ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(methanesulfonamido)phenyl]propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 70247387) has the molecular formula C31H34F3N5O8S2 and a molecular weight of 725.77 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(methanesulfonamido)phenyl]propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(methanesulfonamido)phenyl]propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70247387 |
| Molecular Formula | C31H34F3N5O8S2 |
| Molecular Weight | 725.77 g/mol |
| Exact Mass | 725.18 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-[4-(methanesulfonamido)phenyl]propanoyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C(=O)N[C@@H](Cc2ccc(NS(C)(=O)=O)cc2)C(=O)N2CCc3sc(CC(=O)OCC)cc3C2)cc1 |
| InChI | InChI=1S/C29H33N5O6S2.C2HF3O2/c1-3-40-26(35)16-23-15-21-17-34(13-12-25(21)41-23)29(37)24(14-18-4-10-22(11-5-18)33-42(2,38)39)32-28(36)20-8-6-19(7-9-20)27(30)31;3-2(4,5)1(6)7/h4-11,15,24,33H,3,12-14,16-17H2,1-2H3,(H3,30,31)(H,32,36);(H,6,7)/t24-;/m0./s1 |
| InChIKey | FWVLCRHTXWUJGC-JIDHJSLPSA-N |
| XLogP | 3.07 |
| TPSA | 209.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|