C30H31F3N6O8 — CID 70244563
ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid (PubChem CID 70244563) has the molecular formula C30H31F3N6O8 and a molecular weight of 660.61 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70244563 |
| Molecular Formula | C30H31F3N6O8 |
| Molecular Weight | 660.61 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C(=O)N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)N2CCc3cn(CC(=O)OCC)cc3C2)cc1 |
| InChI | InChI=1S/C28H30N6O6.C2HF3O2/c1-2-40-25(35)17-32-14-21-11-12-33(16-22(21)15-32)28(37)24(13-18-3-9-23(10-4-18)34(38)39)31-27(36)20-7-5-19(6-8-20)26(29)30;3-2(4,5)1(6)7/h3-10,14-15,24H,2,11-13,16-17H2,1H3,(H3,29,30)(H,31,36);(H,6,7)/t24-;/m0./s1 |
| InChIKey | OWWKRYZABGRQBK-JIDHJSLPSA-N |
| XLogP | 2.80 |
| TPSA | 210.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|