C26H28N8O6 — CID 20672006
ethyl 2-[5-[(2S)-2-[(5-carbamimidoylpyridine-2-carbonyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate (PubChem CID 20672006) has the molecular formula C26H28N8O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(5-carbamimidoylpyridine-2-carbonyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[(2S)-2-[(5-carbamimidoylpyridine-2-carbonyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 20672006 |
| Molecular Formula | C26H28N8O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(5-carbamimidoylpyridine-2-carbonyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)N2CCc3nn(CC(=O)OCC)cc3C2)nc1 |
| InChI | InChI=1S/C26H28N8O6/c1-2-40-23(35)15-33-14-18-13-32(10-9-20(18)31-33)26(37)22(11-16-3-6-19(7-4-16)34(38)39)30-25(36)21-8-5-17(12-29-21)24(27)28/h3-8,12,14,22H,2,9-11,13,15H2,1H3,(H3,27,28)(H,30,36)/t22-/m0/s1 |
| InChIKey | YEVFZMFCYIQHAJ-QFIPXVFZSA-N |
| XLogP | 0.96 |
| TPSA | 199.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|