C27H29N7O6 — CID 20671991
ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-1-yl]acetate (PubChem CID 20671991) has the molecular formula C27H29N7O6 and a molecular weight of 547.57 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-1-yl]acetate.
| Compound Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 20671991 |
| Molecular Formula | C27H29N7O6 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(4-carbamimidoylbenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)N2CCc3c(cnn3CC(=O)OCC)C2)cc1 |
| InChI | InChI=1S/C27H29N7O6/c1-2-40-24(35)16-33-23-11-12-32(15-20(23)14-30-33)27(37)22(13-17-3-9-21(10-4-17)34(38)39)31-26(36)19-7-5-18(6-8-19)25(28)29/h3-10,14,22H,2,11-13,15-16H2,1H3,(H3,28,29)(H,31,36)/t22-/m0/s1 |
| InChIKey | NXXREPWBPLNHKC-QFIPXVFZSA-N |
| XLogP | 1.56 |
| TPSA | 186.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|