C28H30N6O7S — CID 20672037
ethyl 2-[5-[(2S)-2-[(4-carbamothioyl-2-methoxybenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate (PubChem CID 20672037) has the molecular formula C28H30N6O7S and a molecular weight of 594.65 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(4-carbamothioyl-2-methoxybenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[(2S)-2-[(4-carbamothioyl-2-methoxybenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 20672037 |
| Molecular Formula | C28H30N6O7S |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(4-carbamothioyl-2-methoxybenzoyl)amino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-2-yl]acetate |
| SMILES | CCOC(=O)Cn1cc2c(n1)CCN(C(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc(C(N)=S)cc1OC)C2 |
| InChI | InChI=1S/C28H30N6O7S/c1-3-41-25(35)16-33-15-19-14-32(11-10-22(19)31-33)28(37)23(12-17-4-7-20(8-5-17)34(38)39)30-27(36)21-9-6-18(26(29)42)13-24(21)40-2/h4-9,13,15,23H,3,10-12,14,16H2,1-2H3,(H2,29,42)(H,30,36)/t23-/m0/s1 |
| InChIKey | YBRCKMSJTONURP-QHCPKHFHSA-N |
| XLogP | 1.92 |
| TPSA | 171.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|