C25H32N4O7 — CID 20672092
ethyl 2-[5-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate (PubChem CID 20672092) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is ethyl 2-[5-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 20672092 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | ethyl 2-[5-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]-6,7-dihydro-4H-pyrrolo[3,4-c]pyridin-2-yl]acetate |
| SMILES | CCOC(=O)Cn1cc2c(c1)CN(C(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C25H32N4O7/c1-5-35-22(30)16-27-13-18-10-11-28(15-19(18)14-27)23(31)21(26-24(32)36-25(2,3)4)12-17-6-8-20(9-7-17)29(33)34/h6-9,13-14,21H,5,10-12,15-16H2,1-4H3,(H,26,32)/t21-/m0/s1 |
| InChIKey | JOEXIYULHOIJLE-NRFANRHFSA-N |
| XLogP | 2.98 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|