C25H32N4O6 — CID 22842199
tert-butyl N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 22842199) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22842199 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H](Cc3ccc([N+](=O)[O-])cc3)NC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O6/c1-25(2,3)35-24(31)26-22(17-18-5-7-20(8-6-18)29(32)33)23(30)28-15-13-27(14-16-28)19-9-11-21(34-4)12-10-19/h5-12,22H,13-17H2,1-4H3,(H,26,31)/t22-/m0/s1 |
| InChIKey | VVOIUZUMNMDHQM-QFIPXVFZSA-N |
| XLogP | 3.39 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|