C48H42N2O2 — CID 130195281
2-N,9-N-bis(4-methoxyphenyl)-4,14,14-trimethyl-2-N,9-N-diphenylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8,10,15(19),16-octaene-2,9-diamine (PubChem CID 130195281) has the molecular formula C48H42N2O2 and a molecular weight of 678.88 g/mol. Its IUPAC name is 2-N,9-N-bis(4-methoxyphenyl)-4,14,14-trimethyl-2-N,9-N-diphenylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8,10,15(19),16-octaene-2,9-diamine.
| Compound Name | 2-N,9-N-bis(4-methoxyphenyl)-4,14,14-trimethyl-2-N,9-N-diphenylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8,10,15(19),16-octaene-2,9-diamine |
|---|---|
| PubChem CID | 130195281 |
| Molecular Formula | C48H42N2O2 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | 2-N,9-N-bis(4-methoxyphenyl)-4,14,14-trimethyl-2-N,9-N-diphenylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8,10,15(19),16-octaene-2,9-diamine |
| SMILES | COc1ccc(N(c2ccccc2)c2cc(C)c3ccc4c(N(c5ccccc5)c5ccc(OC)cc5)cc5c6c(cc2c3c46)C(C)(C)CC5)cc1 |
| InChI | InChI=1S/C48H42N2O2/c1-31-28-43(49(33-12-8-6-9-13-33)35-16-20-37(51-4)21-17-35)41-30-42-45-32(26-27-48(42,2)3)29-44(40-25-24-39(31)46(41)47(40)45)50(34-14-10-7-11-15-34)36-18-22-38(52-5)23-19-36/h6-25,28-30H,26-27H2,1-5H3 |
| InChIKey | OFBKDIWANNBMBY-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|