C56H58N2 — CID 130195365
2-N,2-N,9-N,9-N-tetrakis(3,5-dimethylphenyl)-14,14-dimethyl-4-propan-2-ylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(19),2,4,6,8,10,15,17-octaene-2,9-diamine (PubChem CID 130195365) has the molecular formula C56H58N2 and a molecular weight of 759.09 g/mol. Its IUPAC name is 2-N,2-N,9-N,9-N-tetrakis(3,5-dimethylphenyl)-14,14-dimethyl-4-propan-2-ylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(19),2,4,6,8,10,15,17-octaene-2,9-diamine.
| Compound Name | 2-N,2-N,9-N,9-N-tetrakis(3,5-dimethylphenyl)-14,14-dimethyl-4-propan-2-ylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(19),2,4,6,8,10,15,17-octaene-2,9-diamine |
|---|---|
| PubChem CID | 130195365 |
| Molecular Formula | C56H58N2 |
| Molecular Weight | 759.09 g/mol |
| Exact Mass | 758.46 |
| IUPAC Name | 2-N,2-N,9-N,9-N-tetrakis(3,5-dimethylphenyl)-14,14-dimethyl-4-propan-2-ylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1(19),2,4,6,8,10,15,17-octaene-2,9-diamine |
| SMILES | Cc1cc(C)cc(N(c2cc(C)cc(C)c2)c2cc(C(C)C)c3ccc4c(N(c5cc(C)cc(C)c5)c5cc(C)cc(C)c5)cc5c6c(cc2c3c46)C(C)(C)CC5)c1 |
| InChI | InChI=1S/C56H58N2/c1-32(2)48-31-52(58(44-25-37(7)19-38(8)26-44)45-27-39(9)20-40(10)28-45)49-30-50-53-41(15-16-56(50,11)12)29-51(47-14-13-46(48)54(49)55(47)53)57(42-21-33(3)17-34(4)22-42)43-23-35(5)18-36(6)24-43/h13-14,17-32H,15-16H2,1-12H3 |
| InChIKey | JUVBVVCXTLPYPY-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.09 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|