C34H39FN6O9 — CID 130196006
(2S)-2-amino-6-[[(2S)-2-[[2-[4-[(2S)-2-carboxy-2-[[2-[(6-fluoropyridine-3-carbonyl)amino]acetyl]amino]ethyl]phenoxy]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 130196006) has the molecular formula C34H39FN6O9 and a molecular weight of 694.72 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(2S)-2-[[2-[4-[(2S)-2-carboxy-2-[[2-[(6-fluoropyridine-3-carbonyl)amino]acetyl]amino]ethyl]phenoxy]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(2S)-2-[[2-[4-[(2S)-2-carboxy-2-[[2-[(6-fluoropyridine-3-carbonyl)amino]acetyl]amino]ethyl]phenoxy]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 130196006 |
| Molecular Formula | C34H39FN6O9 |
| Molecular Weight | 694.72 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | (2S)-2-amino-6-[[(2S)-2-[[2-[4-[(2S)-2-carboxy-2-[[2-[(6-fluoropyridine-3-carbonyl)amino]acetyl]amino]ethyl]phenoxy]acetyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)COc1ccc(C[C@H](NC(=O)CNC(=O)c2ccc(F)nc2)C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C34H39FN6O9/c35-28-14-11-23(18-38-28)31(44)39-19-29(42)41-27(34(48)49)17-22-9-12-24(13-10-22)50-20-30(43)40-26(16-21-6-2-1-3-7-21)32(45)37-15-5-4-8-25(36)33(46)47/h1-3,6-7,9-14,18,25-27H,4-5,8,15-17,19-20,36H2,(H,37,45)(H,39,44)(H,40,43)(H,41,42)(H,46,47)(H,48,49)/t25-,26-,27-/m0/s1 |
| InChIKey | CEONXAFEUWDMKP-QKDODKLFSA-N |
| XLogP | 0.57 |
| TPSA | 239.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.72 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|