C16H17FN2O2S — CID 130196521
piperidin-4-yl N-[2-(4-fluorophenyl)thiophen-3-yl]carbamate (PubChem CID 130196521) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is piperidin-4-yl N-[2-(4-fluorophenyl)thiophen-3-yl]carbamate.
| Compound Name | piperidin-4-yl N-[2-(4-fluorophenyl)thiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 130196521 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | piperidin-4-yl N-[2-(4-fluorophenyl)thiophen-3-yl]carbamate |
| SMILES | O=C(Nc1ccsc1-c1ccc(F)cc1)OC1CCNCC1 |
| InChI | InChI=1S/C16H17FN2O2S/c17-12-3-1-11(2-4-12)15-14(7-10-22-15)19-16(20)21-13-5-8-18-9-6-13/h1-4,7,10,13,18H,5-6,8-9H2,(H,19,20) |
| InChIKey | XKMJLRCTOUDGAE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |