C17H21N3O2S — CID 71465924
piperidin-4-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate (PubChem CID 71465924) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is piperidin-4-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate.
| Compound Name | piperidin-4-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 71465924 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | piperidin-4-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)OCC1CCNCC1 |
| InChI | InChI=1S/C17H21N3O2S/c18-14-4-3-13(16-2-1-9-23-16)10-15(14)20-17(21)22-11-12-5-7-19-8-6-12/h1-4,9-10,12,19H,5-8,11,18H2,(H,20,21) |
| InChIKey | QATCENZWWPFVSN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|