C22H26ClN7O2 — CID 130197041
4-amino-2-[[6-(3-chloro-4-hydroxyanilino)pyrimidin-4-yl]amino]-5-[2-(dimethylamino)ethyl-methylamino]benzaldehyde (PubChem CID 130197041) has the molecular formula C22H26ClN7O2 and a molecular weight of 455.95 g/mol. Its IUPAC name is 4-amino-2-[[6-(3-chloro-4-hydroxyanilino)pyrimidin-4-yl]amino]-5-[2-(dimethylamino)ethyl-methylamino]benzaldehyde.
| Compound Name | 4-amino-2-[[6-(3-chloro-4-hydroxyanilino)pyrimidin-4-yl]amino]-5-[2-(dimethylamino)ethyl-methylamino]benzaldehyde |
|---|---|
| PubChem CID | 130197041 |
| Molecular Formula | C22H26ClN7O2 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-amino-2-[[6-(3-chloro-4-hydroxyanilino)pyrimidin-4-yl]amino]-5-[2-(dimethylamino)ethyl-methylamino]benzaldehyde |
| SMILES | CN(C)CCN(C)c1cc(C=O)c(Nc2cc(Nc3ccc(O)c(Cl)c3)ncn2)cc1N |
| InChI | InChI=1S/C22H26ClN7O2/c1-29(2)6-7-30(3)19-8-14(12-31)18(10-17(19)24)28-22-11-21(25-13-26-22)27-15-4-5-20(32)16(23)9-15/h4-5,8-13,32H,6-7,24H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | WLOIKOUJCSTYBL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|