C24H20N2O4S — CID 1301972
N-[5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 1301972) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1301972 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[5-[[3-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cc(C=C2SC(NC(C)=O)=NC2=O)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H20N2O4S/c1-15(27)25-24-26-23(28)22(31-24)13-16-10-11-20(21(12-16)29-2)30-14-18-8-5-7-17-6-3-4-9-19(17)18/h3-13H,14H2,1-2H3,(H,25,26,27,28) |
| InChIKey | WHAHOCZQRKDPAR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|