C14H18O6 — CID 130200412
4-butan-2-yl-4-(2-carboxyethenyl)hepta-2,5-dienedioic acid (PubChem CID 130200412) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-butan-2-yl-4-(2-carboxyethenyl)hepta-2,5-dienedioic acid.
| Compound Name | 4-butan-2-yl-4-(2-carboxyethenyl)hepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 130200412 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-butan-2-yl-4-(2-carboxyethenyl)hepta-2,5-dienedioic acid |
| SMILES | CCC(C)C(C=CC(=O)O)(C=CC(=O)O)C=CC(=O)O |
| InChI | InChI=1S/C14H18O6/c1-3-10(2)14(7-4-11(15)16,8-5-12(17)18)9-6-13(19)20/h4-10H,3H2,1-2H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | CDSQKCZKLWZHHM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|