C24H24S2 — CID 13020090
3,11-bis(tert-butylsulfanyl)pentacyclo[11.3.0.02,4.05,9.010,12]hexadeca-1(16),2,4,6,8,10,12,14-octaene (PubChem CID 13020090) has the molecular formula C24H24S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 3,11-bis(tert-butylsulfanyl)pentacyclo[11.3.0.02,4.05,9.010,12]hexadeca-1(16),2,4,6,8,10,12,14-octaene.
| Compound Name | 3,11-bis(tert-butylsulfanyl)pentacyclo[11.3.0.02,4.05,9.010,12]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 13020090 |
| Molecular Formula | C24H24S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3,11-bis(tert-butylsulfanyl)pentacyclo[11.3.0.02,4.05,9.010,12]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
| SMILES | CC(C)(C)Sc1c2c3cccc3c3c(SC(C)(C)C)c3c3cccc3c12 |
| InChI | InChI=1S/C24H24S2/c1-23(2,3)25-21-17-13-9-7-11-15(13)19-20(22(19)26-24(4,5)6)16-12-8-10-14(16)18(17)21/h7-12H,1-6H3/b17-13+,18-14+,19-15+,20-16+ |
| InChIKey | KHRJSNNDNNEMIA-AQWWNALJSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |