C27H36FN7O2S — CID 130203465
5-[amino-[3-fluoro-5-(1,4,7-oxadiazecan-7-yl)-2-pyridinyl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide (PubChem CID 130203465) has the molecular formula C27H36FN7O2S and a molecular weight of 541.70 g/mol. Its IUPAC name is 5-[amino-[3-fluoro-5-(1,4,7-oxadiazecan-7-yl)-2-pyridinyl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-[amino-[3-fluoro-5-(1,4,7-oxadiazecan-7-yl)-2-pyridinyl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130203465 |
| Molecular Formula | C27H36FN7O2S |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 5-[amino-[3-fluoro-5-(1,4,7-oxadiazecan-7-yl)-2-pyridinyl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1sc2cnc(N(N)c3ncc(N4CCCOCCNCC4)cc3F)cc2c1C1CCCC1 |
| InChI | InChI=1S/C27H36FN7O2S/c1-33(2)27(36)25-24(18-6-3-4-7-18)20-15-23(31-17-22(20)38-25)35(29)26-21(28)14-19(16-32-26)34-10-5-12-37-13-9-30-8-11-34/h14-18,30H,3-13,29H2,1-2H3 |
| InChIKey | CTBSCBWXAGETTO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|