C29H41N9OS — CID 130203706
5-[amino-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pyrazin-2-yl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide (PubChem CID 130203706) has the molecular formula C29H41N9OS and a molecular weight of 563.78 g/mol. Its IUPAC name is 5-[amino-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pyrazin-2-yl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 5-[amino-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pyrazin-2-yl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130203706 |
| Molecular Formula | C29H41N9OS |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | 5-[amino-[5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]pyrazin-2-yl]amino]-3-cyclopentyl-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CN1CCC(N2CCN(c3cnc(N(N)c4cc5c(C6CCCC6)c(C(=O)N(C)C)sc5cn4)cn3)CC2)CC1 |
| InChI | InChI=1S/C29H41N9OS/c1-34(2)29(39)28-27(20-6-4-5-7-20)22-16-24(31-17-23(22)40-28)38(30)26-19-32-25(18-33-26)37-14-12-36(13-15-37)21-8-10-35(3)11-9-21/h16-21H,4-15,30H2,1-3H3 |
| InChIKey | QOFMWTSAQXXVOG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|