C18H18N2O5S — CID 130204627
N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide (PubChem CID 130204627) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide.
| Compound Name | N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 130204627 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-hydroxy-1-[4-(4-hydroxyphenyl)phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide |
| SMILES | O=C(NO)C1=CCN(S(=O)(=O)c2ccc(-c3ccc(O)cc3)cc2)CC1 |
| InChI | InChI=1S/C18H18N2O5S/c21-16-5-1-13(2-6-16)14-3-7-17(8-4-14)26(24,25)20-11-9-15(10-12-20)18(22)19-23/h1-9,21,23H,10-12H2,(H,19,22) |
| InChIKey | HNUJSXFRFZYZHO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|