C21H26N4O4S — CID 167003334
N-hydroxy-1-[4-[4-[2-(methylamino)ethylamino]phenyl]phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide (PubChem CID 167003334) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-hydroxy-1-[4-[4-[2-(methylamino)ethylamino]phenyl]phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide.
| Compound Name | N-hydroxy-1-[4-[4-[2-(methylamino)ethylamino]phenyl]phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167003334 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-hydroxy-1-[4-[4-[2-(methylamino)ethylamino]phenyl]phenyl]sulfonyl-3,6-dihydro-2H-pyridine-4-carboxamide |
| SMILES | CNCCNc1ccc(-c2ccc(S(=O)(=O)N3CC=C(C(=O)NO)CC3)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-22-12-13-23-19-6-2-16(3-7-19)17-4-8-20(9-5-17)30(28,29)25-14-10-18(11-15-25)21(26)24-27/h2-10,22-23,27H,11-15H2,1H3,(H,24,26) |
| InChIKey | ZPKSKSTYBMWBKX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|