C14H10Br2N2 — CID 130205790
2-(2,6-dibromophenyl)-1-methylbenzimidazole (PubChem CID 130205790) has the molecular formula C14H10Br2N2 and a molecular weight of 366.06 g/mol. Its IUPAC name is 2-(2,6-dibromophenyl)-1-methylbenzimidazole.
| Compound Name | 2-(2,6-dibromophenyl)-1-methylbenzimidazole |
|---|---|
| PubChem CID | 130205790 |
| Molecular Formula | C14H10Br2N2 |
| Molecular Weight | 366.06 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-(2,6-dibromophenyl)-1-methylbenzimidazole |
| SMILES | Cn1c(-c2c(Br)cccc2Br)nc2ccccc21 |
| InChI | InChI=1S/C14H10Br2N2/c1-18-12-8-3-2-7-11(12)17-14(18)13-9(15)5-4-6-10(13)16/h2-8H,1H3 |
| InChIKey | WCDPRCCFKSEWTC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |